C16H21F3O2 — CID 153282415
2,3-difluoro-1-(2-fluorobutoxy)-4-[(E)-4-methylpent-2-enoxy]benzene (PubChem CID 153282415) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 2,3-difluoro-1-(2-fluorobutoxy)-4-[(E)-4-methylpent-2-enoxy]benzene.
| Compound Name | 2,3-difluoro-1-(2-fluorobutoxy)-4-[(E)-4-methylpent-2-enoxy]benzene |
|---|---|
| PubChem CID | 153282415 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2,3-difluoro-1-(2-fluorobutoxy)-4-[(E)-4-methylpent-2-enoxy]benzene |
| SMILES | CCC(F)COc1ccc(OC/C=C/C(C)C)c(F)c1F |
| InChI | InChI=1S/C16H21F3O2/c1-4-12(17)10-21-14-8-7-13(15(18)16(14)19)20-9-5-6-11(2)3/h5-8,11-12H,4,9-10H2,1-3H3/b6-5+ |
| InChIKey | SSCQPPAUIAIYMI-AATRIKPKSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|