C18H26F4O2 — CID 153282509
2,3-difluoro-1,4-bis(4-fluorohexoxy)benzene (PubChem CID 153282509) has the molecular formula C18H26F4O2 and a molecular weight of 350.40 g/mol. Its IUPAC name is 2,3-difluoro-1,4-bis(4-fluorohexoxy)benzene.
| Compound Name | 2,3-difluoro-1,4-bis(4-fluorohexoxy)benzene |
|---|---|
| PubChem CID | 153282509 |
| Molecular Formula | C18H26F4O2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2,3-difluoro-1,4-bis(4-fluorohexoxy)benzene |
| SMILES | CCC(F)CCCOc1ccc(OCCCC(F)CC)c(F)c1F |
| InChI | InChI=1S/C18H26F4O2/c1-3-13(19)7-5-11-23-15-9-10-16(18(22)17(15)21)24-12-6-8-14(20)4-2/h9-10,13-14H,3-8,11-12H2,1-2H3 |
| InChIKey | CYVOEVVETMLTKA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|