C20H22F2O2S — CID 125470974
3-ethoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzothiophene (PubChem CID 125470974) has the molecular formula C20H22F2O2S and a molecular weight of 364.46 g/mol. Its IUPAC name is 3-ethoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzothiophene.
| Compound Name | 3-ethoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzothiophene |
|---|---|
| PubChem CID | 125470974 |
| Molecular Formula | C20H22F2O2S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-ethoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzothiophene |
| SMILES | CCOc1ccc2c(sc3c(F)c(OCCCC(C)C)ccc32)c1F |
| InChI | InChI=1S/C20H22F2O2S/c1-4-23-15-9-7-13-14-8-10-16(24-11-5-6-12(2)3)18(22)20(14)25-19(13)17(15)21/h7-10,12H,4-6,11H2,1-3H3 |
| InChIKey | AOGUKMTYJFTNTD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|