C20H18F2O2S — CID 170293379
3-(cyclopent-3-en-1-ylmethoxy)-7-ethoxy-4,6-difluorodibenzothiophene (PubChem CID 170293379) has the molecular formula C20H18F2O2S and a molecular weight of 360.43 g/mol. Its IUPAC name is 3-(cyclopent-3-en-1-ylmethoxy)-7-ethoxy-4,6-difluorodibenzothiophene.
| Compound Name | 3-(cyclopent-3-en-1-ylmethoxy)-7-ethoxy-4,6-difluorodibenzothiophene |
|---|---|
| PubChem CID | 170293379 |
| Molecular Formula | C20H18F2O2S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-(cyclopent-3-en-1-ylmethoxy)-7-ethoxy-4,6-difluorodibenzothiophene |
| SMILES | CCOc1ccc2c(sc3c(F)c(OCC4CC=CC4)ccc32)c1F |
| InChI | InChI=1S/C20H18F2O2S/c1-2-23-15-9-7-13-14-8-10-16(24-11-12-5-3-4-6-12)18(22)20(14)25-19(13)17(15)21/h3-4,7-10,12H,2,5-6,11H2,1H3 |
| InChIKey | WKJHAMVBBSUOOQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|