C18H12F4O2S — CID 170268603
3-(cyclopropylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene (PubChem CID 170268603) has the molecular formula C18H12F4O2S and a molecular weight of 368.35 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene.
| Compound Name | 3-(cyclopropylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene |
|---|---|
| PubChem CID | 170268603 |
| Molecular Formula | C18H12F4O2S |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-(cyclopropylmethoxy)-7-(2,2-difluoroethenoxy)-4,6-difluorodibenzothiophene |
| SMILES | FC(F)=COc1ccc2c(sc3c(F)c(OCC4CC4)ccc32)c1F |
| InChI | InChI=1S/C18H12F4O2S/c19-14(20)8-24-13-6-4-11-10-3-5-12(23-7-9-1-2-9)15(21)17(10)25-18(11)16(13)22/h3-6,8-9H,1-2,7H2 |
| InChIKey | LPTPNVPXHMIBID-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|