About 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene
7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene (PubChem CID 164546211) has the molecular formula C24H28F2O2S
and a molecular weight of 418.55 g/mol. Its IUPAC name is 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene.
Molecular Properties
| Compound Name | 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene |
| PubChem CID | 164546211 |
| Molecular Formula | C24H28F2O2S |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene |
| SMILES | CCCCCOc1c(C)cc2c(sc3c(F)c(OCC4CCCC4)ccc32)c1F |
| InChI | InChI=1S/C24H28F2O2S/c1-3-4-7-12-27-22-15(2)13-18-17-10-11-19(28-14-16-8-5-6-9-16)20(25)23(17)29-24(18)21(22)26/h10-11,13,16H,3-9,12,14H2,1-2H3 |
| InChIKey | KKLUWSWOTRDNIF-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene?
The IUPAC name of 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene (CID 164546211) is 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene.
What is the SMILES notation for 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene?
The canonical SMILES for 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene is CCCCCOc1c(C)cc2c(sc3c(F)c(OCC4CCCC4)ccc32)c1F.
What is the InChIKey of 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene?
The InChIKey is KKLUWSWOTRDNIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28F2O2S/c1-3-4-7-12-27-22-15(2)13-18-17-10-11-19(28-14-16-8-5-6-9-16)20(25)23(17)29-24(18)21(22)26/h10-11,13,16H,3-9,12,14H2,1-2H3.
What are the key properties of 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene?
7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene has a molecular weight of 418.55 g/mol, XLogP of 7.78, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(cyclopentylmethoxy)-4,6-difluoro-2-methyl-3-pentoxydibenzothiophene is sourced from PubChem (CID 164546211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).