C17H16F2O2S — CID 118458293
3-butoxy-4,6-difluoro-7-methoxydibenzothiophene (PubChem CID 118458293) has the molecular formula C17H16F2O2S and a molecular weight of 322.38 g/mol. Its IUPAC name is 3-butoxy-4,6-difluoro-7-methoxydibenzothiophene.
| Compound Name | 3-butoxy-4,6-difluoro-7-methoxydibenzothiophene |
|---|---|
| PubChem CID | 118458293 |
| Molecular Formula | C17H16F2O2S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-butoxy-4,6-difluoro-7-methoxydibenzothiophene |
| SMILES | CCCCOc1ccc2c(sc3c(F)c(OC)ccc32)c1F |
| InChI | InChI=1S/C17H16F2O2S/c1-3-4-9-21-13-8-6-11-10-5-7-12(20-2)14(18)16(10)22-17(11)15(13)19/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | CIWAUTUPABEBAL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|