C17H16F2O3 — CID 121245755
3-butoxy-4,6-difluoro-7-methoxydibenzofuran (PubChem CID 121245755) has the molecular formula C17H16F2O3 and a molecular weight of 306.31 g/mol. Its IUPAC name is 3-butoxy-4,6-difluoro-7-methoxydibenzofuran.
| Compound Name | 3-butoxy-4,6-difluoro-7-methoxydibenzofuran |
|---|---|
| PubChem CID | 121245755 |
| Molecular Formula | C17H16F2O3 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-butoxy-4,6-difluoro-7-methoxydibenzofuran |
| SMILES | CCCCOc1ccc2c(oc3c(F)c(OC)ccc32)c1F |
| InChI | InChI=1S/C17H16F2O3/c1-3-4-9-21-13-8-6-11-10-5-7-12(20-2)14(18)16(10)22-17(11)15(13)19/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | QRVXIUBTTNBXFD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|