C19H20F2O3 — CID 118372758
3-ethoxy-4,6-difluoro-7-pentoxydibenzofuran (PubChem CID 118372758) has the molecular formula C19H20F2O3 and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-ethoxy-4,6-difluoro-7-pentoxydibenzofuran.
| Compound Name | 3-ethoxy-4,6-difluoro-7-pentoxydibenzofuran |
|---|---|
| PubChem CID | 118372758 |
| Molecular Formula | C19H20F2O3 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-ethoxy-4,6-difluoro-7-pentoxydibenzofuran |
| SMILES | CCCCCOc1ccc2c(oc3c(F)c(OCC)ccc32)c1F |
| InChI | InChI=1S/C19H20F2O3/c1-3-5-6-11-23-15-10-8-13-12-7-9-14(22-4-2)16(20)18(12)24-19(13)17(15)21/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | FZDRZJNTSNLYCB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|