C21H24F2O3 — CID 125490766
(1S)-1-(4,6-difluoro-7-hexoxydibenzofuran-3-yl)propan-1-ol (PubChem CID 125490766) has the molecular formula C21H24F2O3 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1S)-1-(4,6-difluoro-7-hexoxydibenzofuran-3-yl)propan-1-ol.
| Compound Name | (1S)-1-(4,6-difluoro-7-hexoxydibenzofuran-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 125490766 |
| Molecular Formula | C21H24F2O3 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1S)-1-(4,6-difluoro-7-hexoxydibenzofuran-3-yl)propan-1-ol |
| SMILES | CCCCCCOc1ccc2c(oc3c(F)c([C@@H](O)CC)ccc32)c1F |
| InChI | InChI=1S/C21H24F2O3/c1-3-5-6-7-12-25-17-11-10-14-13-8-9-15(16(24)4-2)18(22)20(13)26-21(14)19(17)23/h8-11,16,24H,3-7,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | WOQRDYUJTMWJIQ-INIZCTEOSA-N |
| XLogP | 6.27 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|