C19H20F2O3 — CID 125490777
(1R)-1-(7-butoxy-4,6-difluorodibenzofuran-3-yl)propan-1-ol (PubChem CID 125490777) has the molecular formula C19H20F2O3 and a molecular weight of 334.36 g/mol. Its IUPAC name is (1R)-1-(7-butoxy-4,6-difluorodibenzofuran-3-yl)propan-1-ol.
| Compound Name | (1R)-1-(7-butoxy-4,6-difluorodibenzofuran-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 125490777 |
| Molecular Formula | C19H20F2O3 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1R)-1-(7-butoxy-4,6-difluorodibenzofuran-3-yl)propan-1-ol |
| SMILES | CCCCOc1ccc2c(oc3c(F)c([C@H](O)CC)ccc32)c1F |
| InChI | InChI=1S/C19H20F2O3/c1-3-5-10-23-15-9-8-12-11-6-7-13(14(22)4-2)16(20)18(11)24-19(12)17(15)21/h6-9,14,22H,3-5,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | XAPCUGCNWWFVPH-CQSZACIVSA-N |
| XLogP | 5.49 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|