C18H18F2O3 — CID 123550664
4,6-difluoro-7-(4-methylpentoxy)dibenzofuran-3-ol (PubChem CID 123550664) has the molecular formula C18H18F2O3 and a molecular weight of 320.33 g/mol. Its IUPAC name is 4,6-difluoro-7-(4-methylpentoxy)dibenzofuran-3-ol.
| Compound Name | 4,6-difluoro-7-(4-methylpentoxy)dibenzofuran-3-ol |
|---|---|
| PubChem CID | 123550664 |
| Molecular Formula | C18H18F2O3 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4,6-difluoro-7-(4-methylpentoxy)dibenzofuran-3-ol |
| SMILES | CC(C)CCCOc1ccc2c(oc3c(F)c(O)ccc32)c1F |
| InChI | InChI=1S/C18H18F2O3/c1-10(2)4-3-9-22-14-8-6-12-11-5-7-13(21)15(19)17(11)23-18(12)16(14)20/h5-8,10,21H,3-4,9H2,1-2H3 |
| InChIKey | GBANJIYAHBDRBF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|