C13H8F2O3 — CID 118372765
4,6-difluoro-7-methoxydibenzofuran-3-ol (PubChem CID 118372765) has the molecular formula C13H8F2O3 and a molecular weight of 250.20 g/mol. Its IUPAC name is 4,6-difluoro-7-methoxydibenzofuran-3-ol.
| Compound Name | 4,6-difluoro-7-methoxydibenzofuran-3-ol |
|---|---|
| PubChem CID | 118372765 |
| Molecular Formula | C13H8F2O3 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 4,6-difluoro-7-methoxydibenzofuran-3-ol |
| SMILES | COc1ccc2c(oc3c(F)c(O)ccc32)c1F |
| InChI | InChI=1S/C13H8F2O3/c1-17-9-5-3-7-6-2-4-8(16)10(14)12(6)18-13(7)11(9)15/h2-5,16H,1H3 |
| InChIKey | VWBGVTXPSPMVFW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |