About 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran
3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran (PubChem CID 163495590) has the molecular formula C17H16F2O3
and a molecular weight of 306.31 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran.
Molecular Properties
| Compound Name | 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran |
| PubChem CID | 163495590 |
| Molecular Formula | C17H16F2O3 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran |
| SMILES | CCOCCc1ccc2c(oc3c(F)c(OC)ccc32)c1F |
| InChI | InChI=1S/C17H16F2O3/c1-3-21-9-8-10-4-5-11-12-6-7-13(20-2)15(19)17(12)22-16(11)14(10)18/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | CQJYWQZKQZUHII-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran?
The IUPAC name of 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran (CID 163495590) is 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran.
What is the SMILES notation for 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran?
The canonical SMILES for 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran is CCOCCc1ccc2c(oc3c(F)c(OC)ccc32)c1F.
What is the InChIKey of 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran?
The InChIKey is CQJYWQZKQZUHII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2O3/c1-3-21-9-8-10-4-5-11-12-6-7-13(20-2)15(19)17(12)22-16(11)14(10)18/h4-7H,3,8-9H2,1-2H3.
What are the key properties of 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran?
3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran has a molecular weight of 306.31 g/mol, XLogP of 4.45, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethoxyethyl)-4,6-difluoro-7-methoxydibenzofuran is sourced from PubChem (CID 163495590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).