C10H12F2O — CID 57195328
1-(2-ethoxyethyl)-2,3-difluorobenzene (PubChem CID 57195328) has the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-2,3-difluorobenzene.
| Compound Name | 1-(2-ethoxyethyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 57195328 |
| Molecular Formula | C10H12F2O |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-(2-ethoxyethyl)-2,3-difluorobenzene |
| SMILES | CCOCCc1cccc(F)c1F |
| InChI | InChI=1S/C10H12F2O/c1-2-13-7-6-8-4-3-5-9(11)10(8)12/h3-5H,2,6-7H2,1H3 |
| InChIKey | MRHSFLDODGVXTG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|