C10H13F2N — CID 93318671
(2R)-4-(2,3-difluorophenyl)butan-2-amine (PubChem CID 93318671) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is (2R)-4-(2,3-difluorophenyl)butan-2-amine.
| Compound Name | (2R)-4-(2,3-difluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 93318671 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (2R)-4-(2,3-difluorophenyl)butan-2-amine |
| SMILES | C[C@@H](N)CCc1cccc(F)c1F |
| InChI | InChI=1S/C10H13F2N/c1-7(13)5-6-8-3-2-4-9(11)10(8)12/h2-4,7H,5-6,13H2,1H3/t7-/m1/s1 |
| InChIKey | DWBIWTROUUQESH-SSDOTTSWSA-N |
| XLogP | 2.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |