C11H13ClF2 — CID 64516100
1-(4-chloropentyl)-2,3-difluorobenzene (PubChem CID 64516100) has the molecular formula C11H13ClF2 and a molecular weight of 218.67 g/mol. Its IUPAC name is 1-(4-chloropentyl)-2,3-difluorobenzene.
| Compound Name | 1-(4-chloropentyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 64516100 |
| Molecular Formula | C11H13ClF2 |
| Molecular Weight | 218.67 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-(4-chloropentyl)-2,3-difluorobenzene |
| SMILES | CC(Cl)CCCc1cccc(F)c1F |
| InChI | InChI=1S/C11H13ClF2/c1-8(12)4-2-5-9-6-3-7-10(13)11(9)14/h3,6-8H,2,4-5H2,1H3 |
| InChIKey | JWALCFSDXJNSLW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|