C11H13Cl3 — CID 65316185
1,4-dichloro-2-(4-chloropentyl)benzene (PubChem CID 65316185) has the molecular formula C11H13Cl3 and a molecular weight of 251.58 g/mol. Its IUPAC name is 1,4-dichloro-2-(4-chloropentyl)benzene.
| Compound Name | 1,4-dichloro-2-(4-chloropentyl)benzene |
|---|---|
| PubChem CID | 65316185 |
| Molecular Formula | C11H13Cl3 |
| Molecular Weight | 251.58 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,4-dichloro-2-(4-chloropentyl)benzene |
| SMILES | CC(Cl)CCCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl3/c1-8(12)3-2-4-9-7-10(13)5-6-11(9)14/h5-8H,2-4H2,1H3 |
| InChIKey | UTRZVBVCIQKCAD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|