C14H19Cl2F — CID 103050556
4-chloro-2-(4-chloro-5,5-dimethylhexyl)-1-fluorobenzene (PubChem CID 103050556) has the molecular formula C14H19Cl2F and a molecular weight of 277.21 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-5,5-dimethylhexyl)-1-fluorobenzene.
| Compound Name | 4-chloro-2-(4-chloro-5,5-dimethylhexyl)-1-fluorobenzene |
|---|---|
| PubChem CID | 103050556 |
| Molecular Formula | C14H19Cl2F |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-chloro-2-(4-chloro-5,5-dimethylhexyl)-1-fluorobenzene |
| SMILES | CC(C)(C)C(Cl)CCCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H19Cl2F/c1-14(2,3)13(16)6-4-5-10-9-11(15)7-8-12(10)17/h7-9,13H,4-6H2,1-3H3 |
| InChIKey | CUNPBAPZHQSFHE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|