C13H17BrF2 — CID 64509441
2-(4-bromo-5-methylhexyl)-1,4-difluorobenzene (PubChem CID 64509441) has the molecular formula C13H17BrF2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-(4-bromo-5-methylhexyl)-1,4-difluorobenzene.
| Compound Name | 2-(4-bromo-5-methylhexyl)-1,4-difluorobenzene |
|---|---|
| PubChem CID | 64509441 |
| Molecular Formula | C13H17BrF2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(4-bromo-5-methylhexyl)-1,4-difluorobenzene |
| SMILES | CC(C)C(Br)CCCc1cc(F)ccc1F |
| InChI | InChI=1S/C13H17BrF2/c1-9(2)12(14)5-3-4-10-8-11(15)6-7-13(10)16/h6-9,12H,3-5H2,1-2H3 |
| InChIKey | PNLXDJOFPZQKOF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|