C15H13BrF2 — CID 55192833
2-(3-bromo-3-phenylpropyl)-1,4-difluorobenzene (PubChem CID 55192833) has the molecular formula C15H13BrF2 and a molecular weight of 311.17 g/mol. Its IUPAC name is 2-(3-bromo-3-phenylpropyl)-1,4-difluorobenzene.
| Compound Name | 2-(3-bromo-3-phenylpropyl)-1,4-difluorobenzene |
|---|---|
| PubChem CID | 55192833 |
| Molecular Formula | C15H13BrF2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-(3-bromo-3-phenylpropyl)-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(CCC(Br)c2ccccc2)c1 |
| InChI | InChI=1S/C15H13BrF2/c16-14(11-4-2-1-3-5-11)8-6-12-10-13(17)7-9-15(12)18/h1-5,7,9-10,14H,6,8H2 |
| InChIKey | UJGOFRJJTFGSGX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|