C17H18BrF — CID 106882583
2-(3-bromo-3-phenylpropyl)-1-fluoro-3,5-dimethylbenzene (PubChem CID 106882583) has the molecular formula C17H18BrF and a molecular weight of 321.23 g/mol. Its IUPAC name is 2-(3-bromo-3-phenylpropyl)-1-fluoro-3,5-dimethylbenzene.
| Compound Name | 2-(3-bromo-3-phenylpropyl)-1-fluoro-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 106882583 |
| Molecular Formula | C17H18BrF |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-(3-bromo-3-phenylpropyl)-1-fluoro-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)c(CCC(Br)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C17H18BrF/c1-12-10-13(2)15(17(19)11-12)8-9-16(18)14-6-4-3-5-7-14/h3-7,10-11,16H,8-9H2,1-2H3 |
| InChIKey | RMAHSPYZZUGRPE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|