C18H21Br — CID 64508120
2-(4-bromo-4-phenylbutyl)-1,4-dimethylbenzene (PubChem CID 64508120) has the molecular formula C18H21Br and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-(4-bromo-4-phenylbutyl)-1,4-dimethylbenzene.
| Compound Name | 2-(4-bromo-4-phenylbutyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 64508120 |
| Molecular Formula | C18H21Br |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-(4-bromo-4-phenylbutyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CCCC(Br)c2ccccc2)c1 |
| InChI | InChI=1S/C18H21Br/c1-14-11-12-15(2)17(13-14)9-6-10-18(19)16-7-4-3-5-8-16/h3-5,7-8,11-13,18H,6,9-10H2,1-2H3 |
| InChIKey | WCSXGRZHCAOXIY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|