C16H27BrS — CID 58078184
bromo-[6-(2,5-dimethylphenyl)hexyl]-dimethyl-λ4-sulfane (PubChem CID 58078184) has the molecular formula C16H27BrS and a molecular weight of 331.36 g/mol. Its IUPAC name is bromo-[6-(2,5-dimethylphenyl)hexyl]-dimethyl-λ4-sulfane.
| Compound Name | bromo-[6-(2,5-dimethylphenyl)hexyl]-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 58078184 |
| Molecular Formula | C16H27BrS |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | bromo-[6-(2,5-dimethylphenyl)hexyl]-dimethyl-λ4-sulfane |
| SMILES | Cc1ccc(C)c(CCCCCCS(C)(C)Br)c1 |
| InChI | InChI=1S/C16H27BrS/c1-14-10-11-15(2)16(13-14)9-7-5-6-8-12-18(3,4)17/h10-11,13H,5-9,12H2,1-4H3 |
| InChIKey | WFRDRVRBCQHQMI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|