C10H15Br — CID 178158630
2-(bromomethyl)-1,4-dimethylbenzene;methane (PubChem CID 178158630) has the molecular formula C10H15Br and a molecular weight of 215.13 g/mol. Its IUPAC name is 2-(bromomethyl)-1,4-dimethylbenzene;methane.
| Compound Name | 2-(bromomethyl)-1,4-dimethylbenzene;methane |
|---|---|
| PubChem CID | 178158630 |
| Molecular Formula | C10H15Br |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-(bromomethyl)-1,4-dimethylbenzene;methane |
| SMILES | C.Cc1ccc(C)c(CBr)c1 |
| InChI | InChI=1S/C9H11Br.CH4/c1-7-3-4-8(2)9(5-7)6-10;/h3-5H,6H2,1-2H3;1H4 |
| InChIKey | VHYYZYWRBJFQIN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|