C12H18BrN — CID 115262334
N-(bromomethyl)-2-(2,5-dimethylphenyl)-N-methylethanamine (PubChem CID 115262334) has the molecular formula C12H18BrN and a molecular weight of 256.19 g/mol. Its IUPAC name is N-(bromomethyl)-2-(2,5-dimethylphenyl)-N-methylethanamine.
| Compound Name | N-(bromomethyl)-2-(2,5-dimethylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115262334 |
| Molecular Formula | C12H18BrN |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-(bromomethyl)-2-(2,5-dimethylphenyl)-N-methylethanamine |
| SMILES | Cc1ccc(C)c(CCN(C)CBr)c1 |
| InChI | InChI=1S/C12H18BrN/c1-10-4-5-11(2)12(8-10)6-7-14(3)9-13/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | OPHXQNDVIQAMBL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|