C13H21NO — CID 115258971
2-(2,5-dimethylphenyl)-N-(methoxymethyl)-N-methylethanamine (PubChem CID 115258971) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-(methoxymethyl)-N-methylethanamine.
| Compound Name | 2-(2,5-dimethylphenyl)-N-(methoxymethyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115258971 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-(methoxymethyl)-N-methylethanamine |
| SMILES | COCN(C)CCc1cc(C)ccc1C |
| InChI | InChI=1S/C13H21NO/c1-11-5-6-12(2)13(9-11)7-8-14(3)10-15-4/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | YNRJNCVYCCOIBQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|