C12H20N2O — CID 115226171
N'-[2-(2-methoxy-5-methylphenyl)ethyl]-N'-methylmethanediamine (PubChem CID 115226171) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N'-[2-(2-methoxy-5-methylphenyl)ethyl]-N'-methylmethanediamine.
| Compound Name | N'-[2-(2-methoxy-5-methylphenyl)ethyl]-N'-methylmethanediamine |
|---|---|
| PubChem CID | 115226171 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N'-[2-(2-methoxy-5-methylphenyl)ethyl]-N'-methylmethanediamine |
| SMILES | COc1ccc(C)cc1CCN(C)CN |
| InChI | InChI=1S/C12H20N2O/c1-10-4-5-12(15-3)11(8-10)6-7-14(2)9-13/h4-5,8H,6-7,9,13H2,1-3H3 |
| InChIKey | OOQSAPGLMDLGAI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|