C13H22N2O — CID 115226227
N'-[2-(2-methoxy-3,5-dimethylphenyl)ethyl]-N'-methylmethanediamine (PubChem CID 115226227) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N'-[2-(2-methoxy-3,5-dimethylphenyl)ethyl]-N'-methylmethanediamine.
| Compound Name | N'-[2-(2-methoxy-3,5-dimethylphenyl)ethyl]-N'-methylmethanediamine |
|---|---|
| PubChem CID | 115226227 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N'-[2-(2-methoxy-3,5-dimethylphenyl)ethyl]-N'-methylmethanediamine |
| SMILES | COc1c(C)cc(C)cc1CCN(C)CN |
| InChI | InChI=1S/C13H22N2O/c1-10-7-11(2)13(16-4)12(8-10)5-6-15(3)9-14/h7-8H,5-6,9,14H2,1-4H3 |
| InChIKey | LVESBQMFTLMEJS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|