C13H20ClNO — CID 115214945
2-chloro-N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylethanamine (PubChem CID 115214945) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-chloro-N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylethanamine.
| Compound Name | 2-chloro-N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 115214945 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-chloro-N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylethanamine |
| SMILES | COc1c(C)cc(C)cc1CN(C)CCCl |
| InChI | InChI=1S/C13H20ClNO/c1-10-7-11(2)13(16-4)12(8-10)9-15(3)6-5-14/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | QKEUJYIHHFLOIU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|