methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate

C13H19NO3 — CID 115190641

IUPACmethyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate
SMILESCOC(=O)N(C)Cc1cc(C)cc(C)c1OC
InChIInChI=1S/C13H19NO3/c1-9-6-10(2)12(16-4)11(7-9)8-14(3)13(15)17-5/h6-7H,8H2,1-5H3
InChIKeyDECAWXJAXZRINB-UHFFFAOYSA-N
MW237.30 g/mol
LogP2.51
Rot. Bonds3

About methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate

methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate (PubChem CID 115190641) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate.

Molecular Properties

Compound Namemethyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate
PubChem CID115190641
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Namemethyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate
SMILESCOC(=O)N(C)Cc1cc(C)cc(C)c1OC
InChIInChI=1S/C13H19NO3/c1-9-6-10(2)12(16-4)11(7-9)8-14(3)13(15)17-5/h6-7H,8H2,1-5H3
InChIKeyDECAWXJAXZRINB-UHFFFAOYSA-N
XLogP2.51
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate?
The IUPAC name of methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate (CID 115190641) is methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate?
The canonical SMILES for methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate is COC(=O)N(C)Cc1cc(C)cc(C)c1OC.
What is the InChIKey of methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate?
The InChIKey is DECAWXJAXZRINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9-6-10(2)12(16-4)11(7-9)8-14(3)13(15)17-5/h6-7H,8H2,1-5H3.
What are the key properties of methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate?
methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate has a molecular weight of 237.30 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2-methoxy-3,5-dimethylphenyl)methyl]-N-methylcarbamate is sourced from PubChem (CID 115190641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).