C15H28O — CID 169219679
ethane;1-ethyl-2-methoxy-3,5-dimethylbenzene (PubChem CID 169219679) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;1-ethyl-2-methoxy-3,5-dimethylbenzene.
| Compound Name | ethane;1-ethyl-2-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 169219679 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | ethane;1-ethyl-2-methoxy-3,5-dimethylbenzene |
| SMILES | CC.CC.CCc1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C11H16O.2C2H6/c1-5-10-7-8(2)6-9(3)11(10)12-4;2*1-2/h6-7H,5H2,1-4H3;2*1-2H3 |
| InChIKey | IEOHKQJZWNXFPH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |