C14H23NO — CID 98014326
N-ethyl-3-(2-methoxy-3,5-dimethylphenyl)propan-1-amine (PubChem CID 98014326) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-ethyl-3-(2-methoxy-3,5-dimethylphenyl)propan-1-amine.
| Compound Name | N-ethyl-3-(2-methoxy-3,5-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 98014326 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-ethyl-3-(2-methoxy-3,5-dimethylphenyl)propan-1-amine |
| SMILES | CCNCCCc1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C14H23NO/c1-5-15-8-6-7-13-10-11(2)9-12(3)14(13)16-4/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | FCBABSZFCYWCRM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|