C13H16O — CID 83941962
1-but-3-ynyl-2-methoxy-3,5-dimethylbenzene (PubChem CID 83941962) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-but-3-ynyl-2-methoxy-3,5-dimethylbenzene.
| Compound Name | 1-but-3-ynyl-2-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 83941962 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-but-3-ynyl-2-methoxy-3,5-dimethylbenzene |
| SMILES | C#CCCc1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C13H16O/c1-5-6-7-12-9-10(2)8-11(3)13(12)14-4/h1,8-9H,6-7H2,2-4H3 |
| InChIKey | ZYTOBAZMPCODEL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|