C14H18O — CID 83941963
2-methoxy-1,5-dimethyl-3-(2-methylbut-3-ynyl)benzene (PubChem CID 83941963) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-methoxy-1,5-dimethyl-3-(2-methylbut-3-ynyl)benzene.
| Compound Name | 2-methoxy-1,5-dimethyl-3-(2-methylbut-3-ynyl)benzene |
|---|---|
| PubChem CID | 83941963 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-methoxy-1,5-dimethyl-3-(2-methylbut-3-ynyl)benzene |
| SMILES | C#CC(C)Cc1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C14H18O/c1-6-10(2)8-13-9-11(3)7-12(4)14(13)15-5/h1,7,9-10H,8H2,2-5H3 |
| InChIKey | GYXZAQVHVJSZQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|