C15H25NO2 — CID 82262565
1-(2-methoxy-3,5-dimethylphenyl)-N-(2-methoxyethyl)propan-2-amine (PubChem CID 82262565) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(2-methoxy-3,5-dimethylphenyl)-N-(2-methoxyethyl)propan-2-amine.
| Compound Name | 1-(2-methoxy-3,5-dimethylphenyl)-N-(2-methoxyethyl)propan-2-amine |
|---|---|
| PubChem CID | 82262565 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-(2-methoxy-3,5-dimethylphenyl)-N-(2-methoxyethyl)propan-2-amine |
| SMILES | COCCNC(C)Cc1cc(C)cc(C)c1OC |
| InChI | InChI=1S/C15H25NO2/c1-11-8-12(2)15(18-5)14(9-11)10-13(3)16-6-7-17-4/h8-9,13,16H,6-7,10H2,1-5H3 |
| InChIKey | XYDGHIWODVJAMS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|