C13H20OS — CID 83941900
3-(2-methoxy-3,5-dimethylphenyl)-2-methylpropane-1-thiol (PubChem CID 83941900) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 3-(2-methoxy-3,5-dimethylphenyl)-2-methylpropane-1-thiol.
| Compound Name | 3-(2-methoxy-3,5-dimethylphenyl)-2-methylpropane-1-thiol |
|---|---|
| PubChem CID | 83941900 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-(2-methoxy-3,5-dimethylphenyl)-2-methylpropane-1-thiol |
| SMILES | COc1c(C)cc(C)cc1CC(C)CS |
| InChI | InChI=1S/C13H20OS/c1-9-5-11(3)13(14-4)12(6-9)7-10(2)8-15/h5-6,10,15H,7-8H2,1-4H3 |
| InChIKey | KKMPUYUTLYKWEA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|