C11H15NO2S — CID 115169975
(2-methoxy-3,5-dimethylphenyl)methylcarbamothioic S-acid (PubChem CID 115169975) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (2-methoxy-3,5-dimethylphenyl)methylcarbamothioic S-acid.
| Compound Name | (2-methoxy-3,5-dimethylphenyl)methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 115169975 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2-methoxy-3,5-dimethylphenyl)methylcarbamothioic S-acid |
| SMILES | COc1c(C)cc(C)cc1CNC(=O)S |
| InChI | InChI=1S/C11H15NO2S/c1-7-4-8(2)10(14-3)9(5-7)6-12-11(13)15/h4-5H,6H2,1-3H3,(H2,12,13,15) |
| InChIKey | ORNIJCZQVNQLPZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|