C12H18O — CID 20747709
1-ethyl-4-methoxy-2,3,5-trimethylbenzene (PubChem CID 20747709) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 1-ethyl-4-methoxy-2,3,5-trimethylbenzene.
| Compound Name | 1-ethyl-4-methoxy-2,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 20747709 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 1-ethyl-4-methoxy-2,3,5-trimethylbenzene |
| SMILES | CCc1cc(C)c(OC)c(C)c1C |
| InChI | InChI=1S/C12H18O/c1-6-11-7-8(2)12(13-5)10(4)9(11)3/h7H,6H2,1-5H3 |
| InChIKey | IWDUXWFDKRXQKN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |