C12H18O2 — CID 82469086
2-(4-methoxy-2,3,5-trimethylphenyl)ethanol (PubChem CID 82469086) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(4-methoxy-2,3,5-trimethylphenyl)ethanol.
| Compound Name | 2-(4-methoxy-2,3,5-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 82469086 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(4-methoxy-2,3,5-trimethylphenyl)ethanol |
| SMILES | COc1c(C)cc(CCO)c(C)c1C |
| InChI | InChI=1S/C12H18O2/c1-8-7-11(5-6-13)9(2)10(3)12(8)14-4/h7,13H,5-6H2,1-4H3 |
| InChIKey | WFMRPFZPBTYNKX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |