C11H15BrO2 — CID 117400972
2-(4-bromo-2-methoxy-3,5-dimethylphenyl)ethanol (PubChem CID 117400972) has the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxy-3,5-dimethylphenyl)ethanol.
| Compound Name | 2-(4-bromo-2-methoxy-3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 117400972 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-(4-bromo-2-methoxy-3,5-dimethylphenyl)ethanol |
| SMILES | COc1c(CCO)cc(C)c(Br)c1C |
| InChI | InChI=1S/C11H15BrO2/c1-7-6-9(4-5-13)11(14-3)8(2)10(7)12/h6,13H,4-5H2,1-3H3 |
| InChIKey | OXFCUORNVQYRLW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |