C10H13BrO3 — CID 84710424
(5-bromo-3,4-dimethoxy-2-methylphenyl)methanol (PubChem CID 84710424) has the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. Its IUPAC name is (5-bromo-3,4-dimethoxy-2-methylphenyl)methanol.
| Compound Name | (5-bromo-3,4-dimethoxy-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 84710424 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | (5-bromo-3,4-dimethoxy-2-methylphenyl)methanol |
| SMILES | COc1c(Br)cc(CO)c(C)c1OC |
| InChI | InChI=1S/C10H13BrO3/c1-6-7(5-12)4-8(11)10(14-3)9(6)13-2/h4,12H,5H2,1-3H3 |
| InChIKey | KELDVDHEPAAMMP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |