C10H14O4 — CID 102196644
5-(hydroxymethyl)-3,4-dimethoxy-2-methylphenol (PubChem CID 102196644) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3,4-dimethoxy-2-methylphenol.
| Compound Name | 5-(hydroxymethyl)-3,4-dimethoxy-2-methylphenol |
|---|---|
| PubChem CID | 102196644 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 5-(hydroxymethyl)-3,4-dimethoxy-2-methylphenol |
| SMILES | COc1c(CO)cc(O)c(C)c1OC |
| InChI | InChI=1S/C10H14O4/c1-6-8(12)4-7(5-11)10(14-3)9(6)13-2/h4,11-12H,5H2,1-3H3 |
| InChIKey | HQXICJFIQDIGFE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |