C8H10O4 — CID 123599997
5-(hydroxymethyl)-4-methylbenzene-1,2,3-triol (PubChem CID 123599997) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-methylbenzene-1,2,3-triol.
| Compound Name | 5-(hydroxymethyl)-4-methylbenzene-1,2,3-triol |
|---|---|
| PubChem CID | 123599997 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5-(hydroxymethyl)-4-methylbenzene-1,2,3-triol |
| SMILES | Cc1c(CO)cc(O)c(O)c1O |
| InChI | InChI=1S/C8H10O4/c1-4-5(3-9)2-6(10)8(12)7(4)11/h2,9-12H,3H2,1H3 |
| InChIKey | MBOKLQQCUGRAIV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|