C8H10O3S — CID 88715495
4-methyl-5-methylsulfanylbenzene-1,2,3-triol (PubChem CID 88715495) has the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. Its IUPAC name is 4-methyl-5-methylsulfanylbenzene-1,2,3-triol.
| Compound Name | 4-methyl-5-methylsulfanylbenzene-1,2,3-triol |
|---|---|
| PubChem CID | 88715495 |
| Molecular Formula | C8H10O3S |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 4-methyl-5-methylsulfanylbenzene-1,2,3-triol |
| SMILES | CSc1cc(O)c(O)c(O)c1C |
| InChI | InChI=1S/C8H10O3S/c1-4-6(12-2)3-5(9)8(11)7(4)10/h3,9-11H,1-2H3 |
| InChIKey | DQDCLYMISLJLJG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|