About 3,7-bis(methylsulfanyl)naphthalene-2,6-diol
3,7-bis(methylsulfanyl)naphthalene-2,6-diol (PubChem CID 125484767) has the molecular formula C12H12O2S2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 3,7-bis(methylsulfanyl)naphthalene-2,6-diol.
Molecular Properties
| Compound Name | 3,7-bis(methylsulfanyl)naphthalene-2,6-diol |
| PubChem CID | 125484767 |
| Molecular Formula | C12H12O2S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 3,7-bis(methylsulfanyl)naphthalene-2,6-diol |
| SMILES | CSc1cc2cc(O)c(SC)cc2cc1O |
| InChI | InChI=1S/C12H12O2S2/c1-15-11-5-7-4-10(14)12(16-2)6-8(7)3-9(11)13/h3-6,13-14H,1-2H3 |
| InChIKey | TUYDVLSEIHKYEF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,7-bis(methylsulfanyl)naphthalene-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis(methylsulfanyl)naphthalene-2,6-diol?
The IUPAC name of 3,7-bis(methylsulfanyl)naphthalene-2,6-diol (CID 125484767) is 3,7-bis(methylsulfanyl)naphthalene-2,6-diol.
What is the SMILES notation for 3,7-bis(methylsulfanyl)naphthalene-2,6-diol?
The canonical SMILES for 3,7-bis(methylsulfanyl)naphthalene-2,6-diol is CSc1cc2cc(O)c(SC)cc2cc1O.
What is the InChIKey of 3,7-bis(methylsulfanyl)naphthalene-2,6-diol?
The InChIKey is TUYDVLSEIHKYEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2S2/c1-15-11-5-7-4-10(14)12(16-2)6-8(7)3-9(11)13/h3-6,13-14H,1-2H3.
What are the key properties of 3,7-bis(methylsulfanyl)naphthalene-2,6-diol?
3,7-bis(methylsulfanyl)naphthalene-2,6-diol has a molecular weight of 252.36 g/mol, XLogP of 3.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis(methylsulfanyl)naphthalene-2,6-diol is sourced from PubChem (CID 125484767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).