C8H8F2OS — CID 151928528
2,5-difluoro-4-(methylsulfanylmethyl)phenol (PubChem CID 151928528) has the molecular formula C8H8F2OS and a molecular weight of 190.21 g/mol. Its IUPAC name is 2,5-difluoro-4-(methylsulfanylmethyl)phenol.
| Compound Name | 2,5-difluoro-4-(methylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 151928528 |
| Molecular Formula | C8H8F2OS |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2,5-difluoro-4-(methylsulfanylmethyl)phenol |
| SMILES | CSCc1cc(F)c(O)cc1F |
| InChI | InChI=1S/C8H8F2OS/c1-12-4-5-2-7(10)8(11)3-6(5)9/h2-3,11H,4H2,1H3 |
| InChIKey | SYHFJBPKKZSPIT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |