C12H18O2S — CID 101177589
5-tert-butyl-3-(methylsulfanylmethyl)benzene-1,2-diol (PubChem CID 101177589) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 5-tert-butyl-3-(methylsulfanylmethyl)benzene-1,2-diol.
| Compound Name | 5-tert-butyl-3-(methylsulfanylmethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 101177589 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5-tert-butyl-3-(methylsulfanylmethyl)benzene-1,2-diol |
| SMILES | CSCc1cc(C(C)(C)C)cc(O)c1O |
| InChI | InChI=1S/C12H18O2S/c1-12(2,3)9-5-8(7-15-4)11(14)10(13)6-9/h5-6,13-14H,7H2,1-4H3 |
| InChIKey | CIORAYBJCWVIFM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|