C21H34OS — CID 102028542
2,4-ditert-butyl-6-(cyclohexylsulfanylmethyl)phenol (PubChem CID 102028542) has the molecular formula C21H34OS and a molecular weight of 334.57 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(cyclohexylsulfanylmethyl)phenol.
| Compound Name | 2,4-ditert-butyl-6-(cyclohexylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 102028542 |
| Molecular Formula | C21H34OS |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 2,4-ditert-butyl-6-(cyclohexylsulfanylmethyl)phenol |
| SMILES | CC(C)(C)c1cc(CSC2CCCCC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H34OS/c1-20(2,3)16-12-15(14-23-17-10-8-7-9-11-17)19(22)18(13-16)21(4,5)6/h12-13,17,22H,7-11,14H2,1-6H3 |
| InChIKey | GKPHPESZHJJTMK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |