C36H58Cl3CoN2O2 — CID 175919926
2,4-ditert-butyl-6-[[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]phenol;trichlorocobalt (PubChem CID 175919926) has the molecular formula C36H58Cl3CoN2O2 and a molecular weight of 716.16 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]phenol;trichlorocobalt.
| Compound Name | 2,4-ditert-butyl-6-[[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]phenol;trichlorocobalt |
|---|---|
| PubChem CID | 175919926 |
| Molecular Formula | C36H58Cl3CoN2O2 |
| Molecular Weight | 716.16 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | 2,4-ditert-butyl-6-[[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]phenol;trichlorocobalt |
| SMILES | CC(C)(C)c1cc(CNC2CCCCC2NCc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.Cl[Co](Cl)Cl |
| InChI | InChI=1S/C36H58N2O2.3ClH.Co/c1-33(2,3)25-17-23(31(39)27(19-25)35(7,8)9)21-37-29-15-13-14-16-30(29)38-22-24-18-26(34(4,5)6)20-28(32(24)40)36(10,11)12;;;;/h17-20,29-30,37-40H,13-16,21-22H2,1-12H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | LGAIYVNLLUWZIP-UHFFFAOYSA-K |
| XLogP | 10.54 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.16 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|